Difference between revisions of "CPD-12179"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TTP == * common-name: ** dttp * smiles: ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])o2)) * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite ENT-KAUR-16-EN-19-OL == * common-name: ** ent-kaurenol * smiles: ** c=c1(c4(cc3(c1)(cc[ch]2(c(c)(co)cccc(c)2[ch]3cc4)))) * inchi-key: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ENT-KAUR-16-EN-19-OL == |
* common-name: | * common-name: | ||
| − | ** | + | ** ent-kaurenol |
* smiles: | * smiles: | ||
| − | ** | + | ** c=c1(c4(cc3(c1)(cc[ch]2(c(c)(co)cccc(c)2[ch]3cc4)))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** tujqvrfwmwrmio-xrnrsjmdsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 288.472 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-5242]] | |
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[1.14.13.78-RXN]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=ent-kaurenol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=tujqvrfwmwrmio-xrnrsjmdsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=288.472}} |
Revision as of 18:58, 14 January 2021
Contents
Metabolite ENT-KAUR-16-EN-19-OL
- common-name:
- ent-kaurenol
- smiles:
- c=c1(c4(cc3(c1)(cc[ch]2(c(c)(co)cccc(c)2[ch]3cc4))))
- inchi-key:
- tujqvrfwmwrmio-xrnrsjmdsa-n
- molecular-weight:
- 288.472
