Difference between revisions of "CPD-12179"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-5-ADP == * common-name: ** adenosine 3',5'-bisphosphate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)op(=o)([o-])[o-]))op([o...")
(Created page with "Category:metabolite == Metabolite CPD-12179 == * common-name: ** methylmalonate semialdehyde == Reaction(s) known to consume the compound == * 1.2.1.27-RXN == Reaction...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-5-ADP ==
+
== Metabolite CPD-12179 ==
 
* common-name:
 
* common-name:
** adenosine 3',5'-bisphosphate
+
** methylmalonate semialdehyde
* smiles:
 
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)op(=o)([o-])[o-]))op([o-])([o-])=o
 
* inchi-key:
 
** whtcpdaxwfldih-kqynxxcusa-j
 
* molecular-weight:
 
** 423.172
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.8.4.8-RXN]]
+
* [[1.2.1.27-RXN]]
* [[325-BISPHOSPHATE-NUCLEOTIDASE-RXN]]
 
* [[ARYLAMINE-SULFOTRANSFERASE-RXN]]
 
* [[PAPSPAPthr]]
 
* [[RXN-10994]]
 
* [[RXN-15587]]
 
* [[RXN-15588]]
 
* [[RXN-15589]]
 
* [[RXN-16759]]
 
* [[RXN-17203]]
 
* [[RXN-701]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
* [[1.8.4.8-RXN]]
 
* [[2.8.2.23-RXN]]
 
* [[2.8.2.29-RXN]]
 
* [[2.8.2.30-RXN]]
 
* [[ARYL-SULFOTRANSFERASE-RXN]]
 
* [[ARYLAMINE-SULFOTRANSFERASE-RXN]]
 
* [[CHONDROITIN-4-SULFOTRANSFERASE-RXN]]
 
* [[ENTDB-RXN]]
 
* [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]]
 
* [[HEPARITIN-SULFOTRANSFERASE-RXN]]
 
* [[HOLO-ACP-SYNTH-RXN]]
 
* [[PAPSPAPthr]]
 
* [[RXN-10614]]
 
* [[RXN-10615]]
 
* [[RXN-10777]]
 
* [[RXN-10782]]
 
* [[RXN-10994]]
 
* [[RXN-11058]]
 
* [[RXN-11059]]
 
* [[RXN-11555]]
 
* [[RXN-15587]]
 
* [[RXN-15588]]
 
* [[RXN-15589]]
 
* [[RXN-15889]]
 
* [[RXN-16759]]
 
* [[RXN-17203]]
 
* [[RXN-18301]]
 
* [[RXN-18303]]
 
* [[RXN-701]]
 
* [[RXN-7953]]
 
* [[RXN-7954]]
 
* [[RXN6666-9]]
 
</div>
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=adenosine 3',5'-bisphosphate}}
+
{{#set: common-name=methylmalonate semialdehyde}}
{{#set: inchi-key=inchikey=whtcpdaxwfldih-kqynxxcusa-j}}
 
{{#set: molecular-weight=423.172}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-12179

  • common-name:
    • methylmalonate semialdehyde

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality