Difference between revisions of "CPD-12179"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite TTP == * common-name: ** dttp * smiles: ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])o2)) * inchi-key: **...")
(Created page with "Category:metabolite == Metabolite CPD-12179 == * common-name: ** methylmalonate semialdehyde == Reaction(s) known to consume the compound == * 1.2.1.27-RXN == Reaction...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite TTP ==
+
== Metabolite CPD-12179 ==
 
* common-name:
 
* common-name:
** dttp
+
** methylmalonate semialdehyde
* smiles:
 
** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])o2))
 
* inchi-key:
 
** nhvnxkfizysceb-xlpzgreqsa-j
 
* molecular-weight:
 
** 478.139
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DTTGY]]
+
* [[1.2.1.27-RXN]]
* [[DTTPtm]]
 
* [[DTTUP]]
 
* [[RXN-14200]]
 
* [[RXN0-5107]]
 
* [[THYMIDINE-TRIPHOSPHATASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ATDTD]]
 
* [[ATDTDm]]
 
* [[DTDPKIN-RXN]]
 
* [[DTTPtm]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dttp}}
+
{{#set: common-name=methylmalonate semialdehyde}}
{{#set: inchi-key=inchikey=nhvnxkfizysceb-xlpzgreqsa-j}}
 
{{#set: molecular-weight=478.139}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-12179

  • common-name:
    • methylmalonate semialdehyde

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality