Difference between revisions of "CPD-12199"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ19344 == * transcription-direction: ** negative * right-end-position: ** 18261 * left-end-position: ** 4304 * centisome-position: ** 1.8847599...") |
(Created page with "Category:metabolite == Metabolite CPD-12199 == * common-name: ** 3s-(4-hydroxyphenyl)-3-hydroxy-propanoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(o)c1(=cc=c(o)...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-12199 == |
| − | * | + | * common-name: |
| − | ** | + | ** 3s-(4-hydroxyphenyl)-3-hydroxy-propanoyl-coa |
| − | + | * smiles: | |
| − | + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(o)c1(=cc=c(o)c=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-] | |
| − | + | * inchi-key: | |
| − | + | ** vddfxumtxcqmfm-ugdqnksbsa-j | |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 927.663 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-11245]] | |
| − | = | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-11244]] | |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | ** | + | {{#set: common-name=3s-(4-hydroxyphenyl)-3-hydroxy-propanoyl-coa}} |
| − | * | + | {{#set: inchi-key=inchikey=vddfxumtxcqmfm-ugdqnksbsa-j}} |
| − | + | {{#set: molecular-weight=927.663}} | |
| − | ** | ||
| − | * [[RXN- | ||
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-12199
- common-name:
- 3s-(4-hydroxyphenyl)-3-hydroxy-propanoyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(o)c1(=cc=c(o)c=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
- inchi-key:
- vddfxumtxcqmfm-ugdqnksbsa-j
- molecular-weight:
- 927.663
