Difference between revisions of "CPD-12221"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 7-METHYLGUANOSINE-5-PHOSPHATE == * common-name: ** n7-methylguanosine 5'-phosphate * smiles: ** c[n+]1(=cn(c2(n=c(n)nc(=o)c1=2))c3(oc(cop...")
(Created page with "Category:metabolite == Metabolite CPD-12221 == * common-name: ** methyl bromide * smiles: ** cbr * inchi-key: ** gzuxjhmpeanegy-uhfffaoysa-n * molecular-weight: ** 94.939...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 7-METHYLGUANOSINE-5-PHOSPHATE ==
+
== Metabolite CPD-12221 ==
 
* common-name:
 
* common-name:
** n7-methylguanosine 5'-phosphate
+
** methyl bromide
 
* smiles:
 
* smiles:
** c[n+]1(=cn(c2(n=c(n)nc(=o)c1=2))c3(oc(cop(=o)([o-])[o-])c(o)c(o)3))
+
** cbr
 
* inchi-key:
 
* inchi-key:
** aokqnzvjjxpuqa-kqynxxcusa-m
+
** gzuxjhmpeanegy-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 376.242
+
** 94.939
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12826]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12826]]
+
* [[RXN-11268]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n7-methylguanosine 5'-phosphate}}
+
{{#set: common-name=methyl bromide}}
{{#set: inchi-key=inchikey=aokqnzvjjxpuqa-kqynxxcusa-m}}
+
{{#set: inchi-key=inchikey=gzuxjhmpeanegy-uhfffaoysa-n}}
{{#set: molecular-weight=376.242}}
+
{{#set: molecular-weight=94.939}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-12221

  • common-name:
    • methyl bromide
  • smiles:
    • cbr
  • inchi-key:
    • gzuxjhmpeanegy-uhfffaoysa-n
  • molecular-weight:
    • 94.939

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality