Difference between revisions of "CPD-12253"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N6-L-threonylcarbamoyladenine37-tRNAs == * common-name: ** an n6-l-threonylcarbamoyladenine37 in trna == Reaction(s) known to consume the...") |
(Created page with "Category:metabolite == Metabolite CPD-9956 == * common-name: ** ubiquinol-8 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-9956 == |
* common-name: | * common-name: | ||
| − | ** | + | ** ubiquinol-8 |
| + | * smiles: | ||
| + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1) | ||
| + | * inchi-key: | ||
| + | ** lojuqfspyhmheo-sghxuwjisa-n | ||
| + | * molecular-weight: | ||
| + | ** 729.137 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[R00281]] | ||
| + | * [[SUCDH_LPAREN_q8_RPAREN_m]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[DHHB-METHYLTRANSFER-RXN]] |
| + | * [[R00281]] | ||
| + | * [[SUCDH_LPAREN_q8_RPAREN_m]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=ubiquinol-8}} |
| + | {{#set: inchi-key=inchikey=lojuqfspyhmheo-sghxuwjisa-n}} | ||
| + | {{#set: molecular-weight=729.137}} | ||
Revision as of 11:15, 15 January 2021
Contents
Metabolite CPD-9956
- common-name:
- ubiquinol-8
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
- inchi-key:
- lojuqfspyhmheo-sghxuwjisa-n
- molecular-weight:
- 729.137
