Difference between revisions of "CPD-12258"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2145 RXN0-2145] == * direction: ** left-to-right * common-name: ** cis-δ5-dodecenoyl-[ac...") |
(Created page with "Category:metabolite == Metabolite CPD-12258 == * common-name: ** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-l-lysyl-d-alanine * smiles: ** cc(c(=o)nc(c(=o...") |
||
(7 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-12258 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-l-lysyl-d-alanine |
− | * | + | * smiles: |
− | ** [ | + | ** cc(c(=o)nc(c(=o)[o-])ccc(=o)nc(cccc[n+])c(nc(c)c(=o)[o-])=o)nc(=o)c(c)oc1(c(o)c(co)oc(c(nc(=o)c)1)op(op(occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)([o-])=o) |
− | = | + | * inchi-key: |
− | + | ** foedsvrzgqixsp-xsoiktqosa-k | |
− | == | + | * molecular-weight: |
− | + | ** 1075.843 | |
− | + | == Reaction(s) known to consume the compound == | |
− | * | + | * [[RXN-11347]] |
− | ** | + | == Reaction(s) known to produce the compound == |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-l-lysyl-d-alanine}} | |
− | ** | + | {{#set: inchi-key=inchikey=foedsvrzgqixsp-xsoiktqosa-k}} |
− | + | {{#set: molecular-weight=1075.843}} | |
− | == | ||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-12258
- common-name:
- udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-l-lysyl-d-alanine
- smiles:
- cc(c(=o)nc(c(=o)[o-])ccc(=o)nc(cccc[n+])c(nc(c)c(=o)[o-])=o)nc(=o)c(c)oc1(c(o)c(co)oc(c(nc(=o)c)1)op(op(occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)([o-])=o)
- inchi-key:
- foedsvrzgqixsp-xsoiktqosa-k
- molecular-weight:
- 1075.843