Difference between revisions of "CPD-12279"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-METHYLTHIOADENOSINE == * common-name: ** s-methyl-5'-thioadenosine * smiles: ** cscc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23))) * inchi-ke...") |
(Created page with "Category:metabolite == Metabolite CPD-8052 == * common-name: ** 1d-chiro-inositol * smiles: ** c1(c(c(c(c(c1o)o)o)o)o)o * inchi-key: ** cdaismweouebre-lkpkboigsa-n * molec...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-8052 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1d-chiro-inositol |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(c(c(c(c(c1o)o)o)o)o)o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** cdaismweouebre-lkpkboigsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 180.157 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-14148]] | |
| − | |||
| − | * [[RXN- | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-14148]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1d-chiro-inositol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cdaismweouebre-lkpkboigsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=180.157}} |
Revision as of 08:27, 15 March 2021
Contents
Metabolite CPD-8052
- common-name:
- 1d-chiro-inositol
- smiles:
- c1(c(c(c(c(c1o)o)o)o)o)o
- inchi-key:
- cdaismweouebre-lkpkboigsa-n
- molecular-weight:
- 180.157
