Difference between revisions of "CPD-12279"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-METHYLTHIOADENOSINE == * common-name: ** s-methyl-5'-thioadenosine * smiles: ** cscc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23))) * inchi-ke...") |
(Created page with "Category:metabolite == Metabolite CPD-12279 == * common-name: ** 2-iminoacetate * smiles: ** c(=o)([o-])c=n * inchi-key: ** tvmuhoaonwhjbv-uhfffaoysa-m * molecular-weight:...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12279 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-iminoacetate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(=o)([o-])c=n |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** tvmuhoaonwhjbv-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 72.043 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[THIAZOLSYN2-RXN]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-11319]] | |
| − | + | * [[RXN-12614]] | |
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | * [[ | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-iminoacetate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=tvmuhoaonwhjbv-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=72.043}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-12279
- common-name:
- 2-iminoacetate
- smiles:
- c(=o)([o-])c=n
- inchi-key:
- tvmuhoaonwhjbv-uhfffaoysa-m
- molecular-weight:
- 72.043
