Difference between revisions of "CPD-12279"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15370 == * common-name: ** trans-lesqueroloyl-coa * smiles: ** ccccccc(o)cc=ccccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...")
(Created page with "Category:metabolite == Metabolite CPD-12279 == * common-name: ** 2-iminoacetate * smiles: ** c(=o)([o-])c=n * inchi-key: ** tvmuhoaonwhjbv-uhfffaoysa-m * molecular-weight:...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15370 ==
+
== Metabolite CPD-12279 ==
 
* common-name:
 
* common-name:
** trans-lesqueroloyl-coa
+
** 2-iminoacetate
 
* smiles:
 
* smiles:
** ccccccc(o)cc=ccccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** c(=o)([o-])c=n
 
* inchi-key:
 
* inchi-key:
** fgrjeqcmqcquqf-fscwmumrsa-j
+
** tvmuhoaonwhjbv-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 1069.99
+
** 72.043
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[THIAZOLSYN2-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14494]]
+
* [[RXN-11319]]
 +
* [[RXN-12614]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=trans-lesqueroloyl-coa}}
+
{{#set: common-name=2-iminoacetate}}
{{#set: inchi-key=inchikey=fgrjeqcmqcquqf-fscwmumrsa-j}}
+
{{#set: inchi-key=inchikey=tvmuhoaonwhjbv-uhfffaoysa-m}}
{{#set: molecular-weight=1069.99}}
+
{{#set: molecular-weight=72.043}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-12279

  • common-name:
    • 2-iminoacetate
  • smiles:
    • c(=o)([o-])c=n
  • inchi-key:
    • tvmuhoaonwhjbv-uhfffaoysa-m
  • molecular-weight:
    • 72.043

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality