Difference between revisions of "CPD-12279"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DNA-containing-a-Apyrimidinic-Sites == * common-name: ** an apyrimidinic site in dna == Reaction(s) known to consume the compound == == R...") |
(Created page with "Category:metabolite == Metabolite CPD-3483 == * common-name: ** hydroxybupropion * smiles: ** cc([n+]c(c)(c)co)c(=o)c1(c=cc=c(cl)c=1) * inchi-key: ** akoaevosdhivfx-uhfffa...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-3483 == |
* common-name: | * common-name: | ||
| − | ** | + | ** hydroxybupropion |
| + | * smiles: | ||
| + | ** cc([n+]c(c)(c)co)c(=o)c1(c=cc=c(cl)c=1) | ||
| + | * inchi-key: | ||
| + | ** akoaevosdhivfx-uhfffaoysa-o | ||
| + | * molecular-weight: | ||
| + | ** 256.752 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN66-181]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=hydroxybupropion}} |
| + | {{#set: inchi-key=inchikey=akoaevosdhivfx-uhfffaoysa-o}} | ||
| + | {{#set: molecular-weight=256.752}} | ||
Revision as of 18:55, 14 January 2021
Contents
Metabolite CPD-3483
- common-name:
- hydroxybupropion
- smiles:
- cc([n+]c(c)(c)co)c(=o)c1(c=cc=c(cl)c=1)
- inchi-key:
- akoaevosdhivfx-uhfffaoysa-o
- molecular-weight:
- 256.752
