Difference between revisions of "CPD-12303"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11700 == * common-name: ** 1d-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate * smiles: ** c1(op(=o)([o-])[o-])(c(op([o-])(=o)...") |
(Created page with "Category:metabolite == Metabolite CPD-10814 == * common-name: ** glycyl-l-proline * smiles: ** c1(n(c(=o)c[n+])c(cc1)c(=o)[o-]) * inchi-key: ** kznqnbzmbzjqjo-yfkpbyrvsa-n...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-10814 == |
* common-name: | * common-name: | ||
| − | ** | + | ** glycyl-l-proline |
* smiles: | * smiles: | ||
| − | ** c1( | + | ** c1(n(c(=o)c[n+])c(cc1)c(=o)[o-]) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** kznqnbzmbzjqjo-yfkpbyrvsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 172.183 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-6988]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=glycyl-l-proline}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kznqnbzmbzjqjo-yfkpbyrvsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=172.183}} |
Revision as of 11:19, 15 January 2021
Contents
Metabolite CPD-10814
- common-name:
- glycyl-l-proline
- smiles:
- c1(n(c(=o)c[n+])c(cc1)c(=o)[o-])
- inchi-key:
- kznqnbzmbzjqjo-yfkpbyrvsa-n
- molecular-weight:
- 172.183
