Difference between revisions of "CPD-12303"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13142 RXN-13142] == * direction: ** left-to-right * common-name: ** nadphx epimerase * ec-numbe...") |
(Created page with "Category:metabolite == Metabolite CPD-12303 == * common-name: ** undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanine * smiles: ** cc(c)=...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-12303 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanine |
− | * | + | * smiles: |
− | ** | + | ** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(op([o-])(=o)oc1(c(nc(=o)c)c(oc(c)c(=o)nc(c)c(=o)nc(c(=o)[o-])ccc(=o)nc(cccc[n+])c(nc(c)c(=o)[o-])=o)c(o)c(co)o1))([o-])=o)c)c)c)c)c)c)c |
− | == | + | * inchi-key: |
− | + | ** kcrofjgxxschga-ygmfixcysa-k | |
− | == | + | * molecular-weight: |
− | + | ** 1598.955 | |
− | + | == Reaction(s) known to consume the compound == | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-11347]] | |
− | * | + | == Reaction(s) of unknown directionality == |
− | ** | + | {{#set: common-name=undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanine}} |
− | * | + | {{#set: inchi-key=inchikey=kcrofjgxxschga-ygmfixcysa-k}} |
− | ** | + | {{#set: molecular-weight=1598.955}} |
− | |||
− | == | ||
− | == | ||
− | * | ||
− | == | ||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-12303
- common-name:
- undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanine
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(op([o-])(=o)oc1(c(nc(=o)c)c(oc(c)c(=o)nc(c)c(=o)nc(c(=o)[o-])ccc(=o)nc(cccc[n+])c(nc(c)c(=o)[o-])=o)c(o)c(co)o1))([o-])=o)c)c)c)c)c)c)c
- inchi-key:
- kcrofjgxxschga-ygmfixcysa-k
- molecular-weight:
- 1598.955