|
|
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PROTOHEMEFERROCHELAT-RXN PROTOHEMEFERROCHELAT-RXN] == | + | == Metabolite TTP == |
| − | * direction:
| |
| − | ** reversible
| |
| | * common-name: | | * common-name: |
| − | ** ferrochelatase | + | ** dttp |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/4.99.1.1 ec-4.99.1.1] | + | ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])o2)) |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[PROTOHEME]][c] '''+''' 2 [[PROTON]][c] '''<=>''' 1 [[FE+2]][c] '''+''' 1 [[PROTOPORPHYRIN_IX]][c]
| + | ** nhvnxkfizysceb-xlpzgreqsa-j |
| − | == Gene(s) associated with this reaction == | + | * molecular-weight: |
| − | * Gene: [[SJ19310]]
| + | ** 478.139 |
| − | ** Category: [[annotation]]
| + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | * [[DTTGY]] |
| − | ** Category: [[orthology]] | + | * [[DTTPtm]] |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | * [[DTTUP]] |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | * [[RXN-14200]] |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | * [[RXN0-5107]] |
| − | * Gene: [[SJ19170]] | + | * [[THYMIDINE-TRIPHOSPHATASE-RXN]] |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | + | * [[ATDTD]] |
| − | == Pathway(s) ==
| + | * [[ATDTDm]] |
| − | * [[PWY0-1415]], superpathway of heme b biosynthesis from uroporphyrinogen-III: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1415 PWY0-1415] | + | * [[DTDPKIN-RXN]] |
| − | ** '''5''' reactions found over '''4''' reactions in the full pathway
| + | * [[DTTPtm]] |
| − | * [[HEMESYN2-PWY]], heme b biosynthesis II (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=HEMESYN2-PWY HEMESYN2-PWY] | + | == Reaction(s) of unknown directionality == |
| − | ** '''3''' reactions found over '''4''' reactions in the full pathway
| + | {{#set: common-name=dttp}} |
| − | * [[HEME-BIOSYNTHESIS-II]], heme b biosynthesis I (aerobic): [http://metacyc.org/META/NEW-IMAGE?object=HEME-BIOSYNTHESIS-II HEME-BIOSYNTHESIS-II] | + | {{#set: inchi-key=inchikey=nhvnxkfizysceb-xlpzgreqsa-j}} |
| − | ** '''4''' reactions found over '''4''' reactions in the full pathway
| + | {{#set: molecular-weight=478.139}} |
| − | == Reconstruction information ==
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a | |
| − | == External links == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22584 22584]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R00310 R00310]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P22830 P22830]
| |
| − | ** [http://www.uniprot.org/uniprot/P22315 P22315]
| |
| − | ** [http://www.uniprot.org/uniprot/P28602 P28602]
| |
| − | ** [http://www.uniprot.org/uniprot/Q05338 Q05338]
| |
| − | ** [http://www.uniprot.org/uniprot/P42043 P42043]
| |
| − | ** [http://www.uniprot.org/uniprot/P23871 P23871]
| |
| − | ** [http://www.uniprot.org/uniprot/P32396 P32396]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9CFB4 Q9CFB4]
| |
| − | ** [http://www.uniprot.org/uniprot/P56107 P56107]
| |
| − | ** [http://www.uniprot.org/uniprot/O67083 O67083]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PI08 Q9PI08]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JVA5 Q9JVA5]
| |
| − | ** [http://www.uniprot.org/uniprot/P22600 P22600]
| |
| − | ** [http://www.uniprot.org/uniprot/P43868 P43868]
| |
| − | ** [http://www.uniprot.org/uniprot/P16622 P16622]
| |
| − | ** [http://www.uniprot.org/uniprot/Q59735 Q59735]
| |
| − | ** [http://www.uniprot.org/uniprot/P43413 P43413]
| |
| − | ** [http://www.uniprot.org/uniprot/P54225 P54225]
| |
| − | ** [http://www.uniprot.org/uniprot/P42045 P42045]
| |
| − | ** [http://www.uniprot.org/uniprot/O64391 O64391]
| |
| − | ** [http://www.uniprot.org/uniprot/P42044 P42044]
| |
| − | </div>
| |
| − | {{#set: direction=reversible}}
| |
| − | {{#set: common-name=ferrochelatase}} | |
| − | {{#set: ec-number=ec-4.99.1.1}} | |
| − | {{#set: nb gene associated=2}} | |
| − | {{#set: nb pathway associated=3}}
| |
| − | {{#set: reconstruction category=annotation|orthology}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_arabidopsis_thaliana|output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome|output_pantograph_nannochloropsis_salina}}
| |
