Difference between revisions of "CPD-12321"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACACT6h ACACT6h] == * direction: ** left-to-right * common-name: ** lauroyl-coa:acetyl-coa c-acyltr...")
(Created page with "Category:metabolite == Metabolite CPD-12321 == * common-name: ** 15-cis-phytoene * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c * inchi-key...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACACT6h ACACT6h] ==
+
== Metabolite CPD-12321 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** lauroyl-coa:acetyl-coa c-acyltransferase
+
** 15-cis-phytoene
−
== Reaction formula ==
+
* smiles:
−
* 1.0 [[ACETYL-COA]][h] '''+''' 1.0 [[LAUROYLCOA-CPD]][h] '''=>''' 1.0 [[CO-A]][h] '''+''' 1.0 [[CPD-10284]][h]
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ21818]]
+
** yvlpjigomtxxlp-bhljudrvsa-n
−
** Category: [[orthology]]
+
* molecular-weight:
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 544.946
−
* Gene: [[SJ14898]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[orthology]]
+
* [[RXN-11355]]
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-12243]]
−
== Pathway(s) ==
+
* [[RXN-12413]]
−
== Reconstruction information  ==
+
== Reaction(s) known to produce the compound ==
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-13323]]
−
== External links  ==
+
* [[RXNARA-8002]]
−
{{#set: direction=left-to-right}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=lauroyl-coa:acetyl-coa c-acyltransferase}}
+
{{#set: common-name=15-cis-phytoene}}
−
{{#set: nb gene associated=2}}
+
{{#set: inchi-key=inchikey=yvlpjigomtxxlp-bhljudrvsa-n}}
−
{{#set: nb pathway associated=0}}
+
{{#set: molecular-weight=544.946}}
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-12321

  • common-name:
    • 15-cis-phytoene
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c
  • inchi-key:
    • yvlpjigomtxxlp-bhljudrvsa-n
  • molecular-weight:
    • 544.946

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-12321&oldid=139525"