Difference between revisions of "CPD-12321"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GlcA-Gal-Gal-Xyl-Proteins == * common-name: ** a [protein]-3-o-(β-d-glca-(1→3)-β-d-gal-(1→3)-β-d-gal-(1→4)-...") |
(Created page with "Category:metabolite == Metabolite CPD-12321 == * common-name: ** 15-cis-phytoene * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c * inchi-key...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12321 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 15-cis-phytoene |
| + | * smiles: | ||
| + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c | ||
| + | * inchi-key: | ||
| + | ** yvlpjigomtxxlp-bhljudrvsa-n | ||
| + | * molecular-weight: | ||
| + | ** 544.946 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-11355]] |
| + | * [[RXN-12243]] | ||
| + | * [[RXN-12413]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-13323]] | ||
| + | * [[RXNARA-8002]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=15-cis-phytoene}} |
| + | {{#set: inchi-key=inchikey=yvlpjigomtxxlp-bhljudrvsa-n}} | ||
| + | {{#set: molecular-weight=544.946}} | ||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-12321
- common-name:
- 15-cis-phytoene
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c
- inchi-key:
- yvlpjigomtxxlp-bhljudrvsa-n
- molecular-weight:
- 544.946
