Difference between revisions of "CPD-12365"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-formyl-L-methionyl-tRNAfmet == * common-name: ** an n-formyl-l-methionyl-[initiator trnamet] == Reaction(s) known to consume the compou...") |
(Created page with "Category:metabolite == Metabolite SEROTONIN == * common-name: ** serotonin * smiles: ** c([n+])cc1(=cnc2(c=cc(o)=cc1=2)) * inchi-key: ** qzaygjvttncvmb-uhfffaoysa-o * mole...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite SEROTONIN == |
* common-name: | * common-name: | ||
− | ** | + | ** serotonin |
+ | * smiles: | ||
+ | ** c([n+])cc1(=cnc2(c=cc(o)=cc1=2)) | ||
+ | * inchi-key: | ||
+ | ** qzaygjvttncvmb-uhfffaoysa-o | ||
+ | * molecular-weight: | ||
+ | ** 177.225 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-10777]] | ||
+ | * [[RXN-10778]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN3DJ-170]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=serotonin}} |
+ | {{#set: inchi-key=inchikey=qzaygjvttncvmb-uhfffaoysa-o}} | ||
+ | {{#set: molecular-weight=177.225}} |
Revision as of 14:54, 5 January 2021
Contents
Metabolite SEROTONIN
- common-name:
- serotonin
- smiles:
- c([n+])cc1(=cnc2(c=cc(o)=cc1=2))
- inchi-key:
- qzaygjvttncvmb-uhfffaoysa-o
- molecular-weight:
- 177.225