Difference between revisions of "CPD-12365"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ12742 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RR-BUTANEDIOL-DEHYDROGEN...") |
(Created page with "Category:metabolite == Metabolite CPD-12365 == * common-name: ** 8-oxo-dgmp * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** aq...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-12365 == |
− | = | + | * common-name: |
− | + | ** 8-oxo-dgmp | |
− | == | + | * smiles: |
− | * | + | ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23))) |
− | * | + | * inchi-key: |
− | *** | + | ** aqivlflyhyfrku-vpeninkcsa-l |
− | == | + | * molecular-weight: |
− | * [[ | + | ** 361.207 |
− | * | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-14205]] |
− | + | == Reaction(s) known to produce the compound == | |
− | {{#set: | + | * [[RXN-11396]] |
− | {{#set: | + | * [[RXN-12816]] |
− | {{#set: | + | * [[RXN-14205]] |
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=8-oxo-dgmp}} | ||
+ | {{#set: inchi-key=inchikey=aqivlflyhyfrku-vpeninkcsa-l}} | ||
+ | {{#set: molecular-weight=361.207}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-12365
- common-name:
- 8-oxo-dgmp
- smiles:
- c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23)))
- inchi-key:
- aqivlflyhyfrku-vpeninkcsa-l
- molecular-weight:
- 361.207