Difference between revisions of "CPD-12461"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite HISTAMINE == * common-name: ** histamine * smiles: ** c1(=c(nc=n1)cc[n+]) * inchi-key: ** ntyjjopfiahurm-uhfffaoysa-o * molecular-weight:...")
(Created page with "Category:metabolite == Metabolite CPD-12461 == * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])([o-])=o)...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite HISTAMINE ==
+
== Metabolite CPD-12461 ==
 +
* smiles:
 +
** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])([o-])=o)c)c)c
 
* common-name:
 
* common-name:
** histamine
+
** tri-trans,hepta-cis-undecaprenyl diphosphate
* smiles:
 
** c1(=c(nc=n1)cc[n+])
 
* inchi-key:
 
** ntyjjopfiahurm-uhfffaoysa-o
 
 
* molecular-weight:
 
* molecular-weight:
** 112.154
+
** 924.251
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HISTIDINE-DECARBOXYLASE-RXN]]
+
* [[RXN-11488]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=histamine}}
+
{{#set: common-name=tri-trans,hepta-cis-undecaprenyl diphosphate}}
{{#set: inchi-key=inchikey=ntyjjopfiahurm-uhfffaoysa-o}}
+
{{#set: molecular-weight=924.251}}
{{#set: molecular-weight=112.154}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-12461

  • smiles:
    • cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])([o-])=o)c)c)c
  • common-name:
    • tri-trans,hepta-cis-undecaprenyl diphosphate
  • molecular-weight:
    • 924.251

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality