Difference between revisions of "CPD-12461"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ22265 == * transcription-direction: ** positive * right-end-position: ** 421755 * left-end-position: ** 419712 * centisome-position: ** 72.03168...") |
(Created page with "Category:metabolite == Metabolite CPD-12461 == * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])([o-])=o)...") |
||
(9 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-12461 == |
− | * | + | * smiles: |
− | ** | + | ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])([o-])=o)c)c)c |
− | * | + | * common-name: |
− | ** | + | ** tri-trans,hepta-cis-undecaprenyl diphosphate |
− | + | * molecular-weight: | |
− | + | ** 924.251 | |
− | * | + | == Reaction(s) known to consume the compound == |
− | ** | + | == Reaction(s) known to produce the compound == |
− | == | + | * [[RXN-11488]] |
− | + | == Reaction(s) of unknown directionality == | |
− | == Reaction(s) | + | {{#set: common-name=tri-trans,hepta-cis-undecaprenyl diphosphate}} |
− | * [[RXN- | + | {{#set: molecular-weight=924.251}} |
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-12461
- smiles:
- cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])([o-])=o)c)c)c
- common-name:
- tri-trans,hepta-cis-undecaprenyl diphosphate
- molecular-weight:
- 924.251