Difference between revisions of "CPD-12461"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9460 == * common-name: ** oleanolate 3 β-d-glucuronoside * smiles: ** cc6(ccc5(ccc1(c(=cc[ch]2(c1(cc[ch]3(c2(ccc(c3(c)c)oc4(c(c(...") |
(Created page with "Category:metabolite == Metabolite CPD-12461 == * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])([o-])=o)...") |
||
(4 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-12461 == |
+ | * smiles: | ||
+ | ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])([o-])=o)c)c)c | ||
* common-name: | * common-name: | ||
− | ** | + | ** tri-trans,hepta-cis-undecaprenyl diphosphate |
− | |||
− | |||
− | |||
− | |||
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 924.251 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-11488]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=tri-trans,hepta-cis-undecaprenyl diphosphate}} |
− | + | {{#set: molecular-weight=924.251}} | |
− | {{#set: molecular-weight= |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-12461
- smiles:
- cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])([o-])=o)c)c)c
- common-name:
- tri-trans,hepta-cis-undecaprenyl diphosphate
- molecular-weight:
- 924.251