|
|
| (8 intermediate revisions by 4 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.148-RXN 2.7.1.148-RXN] == | + | == Metabolite CPD-12481 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** 4-diphosphocytidyl-2-c-methylerythritol kinase | + | ** 7-methylurate |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/2.7.1.148 ec-2.7.1.148] | + | ** cn1(c(=o)nc2(=c1c(=o)nc(=o)n2)) |
| − | == Reaction formula ==
| + | * inchi-key: |
| − | * 1 [[4-CYTIDINE-5-DIPHOSPHO-2-C]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[PROTON]][c]
| + | ** yhnnpkufpwltop-uhfffaoysa-n |
| − | == Gene(s) associated with this reaction == | + | * molecular-weight: |
| − | * Gene: [[SJ02470]] | + | ** 182.138 |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[orthology]] | + | * [[RXN-11521]] |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: common-name=7-methylurate}} |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: inchi-key=inchikey=yhnnpkufpwltop-uhfffaoysa-n}} |
| − | == Pathway(s) == | + | {{#set: molecular-weight=182.138}} |
| − | * [[NONMEVIPP-PWY]], methylerythritol phosphate pathway I: [http://metacyc.org/META/NEW-IMAGE?object=NONMEVIPP-PWY NONMEVIPP-PWY]
| |
| − | ** '''9''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-7560]], methylerythritol phosphate pathway II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7560 PWY-7560]
| |
| − | ** '''9''' reactions found over '''9''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18438 18438]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R05634 R05634]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=4-diphosphocytidyl-2-c-methylerythritol kinase}} | |
| − | {{#set: ec-number=ec-2.7.1.148}} | |
| − | {{#set: nb gene associated=1}} | |
| − | {{#set: nb pathway associated=2}}
| |
| − | {{#set: reconstruction category=orthology|annotation}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_nannochloropsis_salina|output_pantograph_arabidopsis_thaliana|output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
| |
