Difference between revisions of "CPD-12481"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-OXOPIMELOYL-COA == * common-name: ** 3-oxopimeloyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(cccc([o-])=o)=o)=o)cop(=o)(op(=o)(o...") |
(Created page with "Category:metabolite == Metabolite CPD-12481 == * common-name: ** 7-methylurate * smiles: ** cn1(c(=o)nc2(=c1c(=o)nc(=o)n2)) * inchi-key: ** yhnnpkufpwltop-uhfffaoysa-n * m...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12481 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 7-methylurate |
* smiles: | * smiles: | ||
| − | ** | + | ** cn1(c(=o)nc2(=c1c(=o)nc(=o)n2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** yhnnpkufpwltop-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 182.138 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-11521]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=7-methylurate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yhnnpkufpwltop-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=182.138}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-12481
- common-name:
- 7-methylurate
- smiles:
- cn1(c(=o)nc2(=c1c(=o)nc(=o)n2))
- inchi-key:
- yhnnpkufpwltop-uhfffaoysa-n
- molecular-weight:
- 182.138
