Difference between revisions of "CPD-12481"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-GULONATE == * common-name: ** l-gulonate * smiles: ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] * inchi-key: ** rghnjxzeokukbd-qtbdoelssa-m * molec...")
(Created page with "Category:metabolite == Metabolite tRNA-guanosine18 == * common-name: ** a guanosine18 in trna == Reaction(s) known to consume the compound == * 2.1.1.34-RXN == Reactio...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-GULONATE ==
+
== Metabolite tRNA-guanosine18 ==
 
* common-name:
 
* common-name:
** l-gulonate
+
** a guanosine18 in trna
* smiles:
 
** c(o)c(o)c(o)c(o)c(o)c(=o)[o-]
 
* inchi-key:
 
** rghnjxzeokukbd-qtbdoelssa-m
 
* molecular-weight:
 
** 195.149
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.1.1.34-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLUCURONATE-REDUCTASE-RXN]]
 
* [[RXN-8783]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-gulonate}}
+
{{#set: common-name=a guanosine18 in trna}}
{{#set: inchi-key=inchikey=rghnjxzeokukbd-qtbdoelssa-m}}
 
{{#set: molecular-weight=195.149}}
 

Revision as of 18:56, 14 January 2021

Metabolite tRNA-guanosine18

  • common-name:
    • a guanosine18 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality