Difference between revisions of "CPD-12482"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-16475 == * common-name: ** β-d-galactosyl-(1→4)-[α-l-fucosyl-(1→3)]-n-acetyl-β-d-glucosamine * smiles: ** c...")
(Created page with "Category:metabolite == Metabolite CPD0-2352 == * common-name: ** a trna precursor with a 5' extension and a short 3' extension == Reaction(s) known to consume the compound...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-16475 ==
+
== Metabolite CPD0-2352 ==
 
* common-name:
 
* common-name:
** β-d-galactosyl-(1→4)-[α-l-fucosyl-(1→3)]-n-acetyl-β-d-glucosamine
+
** a trna precursor with a 5' extension and a short 3' extension
* smiles:
 
** cc3(c(o)c(o)c(o)c(oc2(c(nc(c)=o)c(o)oc(co)c(oc1(oc(co)c(o)c(o)c(o)1))2))o3)
 
* inchi-key:
 
** hbbozfuqjdyasd-qgtnpelvsa-n
 
* molecular-weight:
 
** 529.494
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15268]]
+
* [[3.1.26.5-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15268]]
+
* [[RXN0-6479]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-galactosyl-(1→4)-[α-l-fucosyl-(1→3)]-n-acetyl-β-d-glucosamine}}
+
{{#set: common-name=a trna precursor with a 5' extension and a short 3' extension}}
{{#set: inchi-key=inchikey=hbbozfuqjdyasd-qgtnpelvsa-n}}
 
{{#set: molecular-weight=529.494}}
 

Revision as of 11:19, 15 January 2021

Metabolite CPD0-2352

  • common-name:
    • a trna precursor with a 5' extension and a short 3' extension

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality