Difference between revisions of "CPD-12483"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ACETYL-P == * common-name: ** acetyl phosphate * smiles: ** cc(op([o-])(=o)[o-])=o * inchi-key: ** lipounrjvlnbcd-uhfffaoysa-l * molecula...") |
(Created page with "Category:metabolite == Metabolite CPD-12483 == * common-name: ** 1,7-dimethylurate * smiles: ** cn1(c(=o)nc2(=c1c(=o)n(c)c(=o)n2)) * inchi-key: ** nofnclgcujjpku-uhfffaoys...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12483 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1,7-dimethylurate |
* smiles: | * smiles: | ||
| − | ** | + | ** cn1(c(=o)nc2(=c1c(=o)n(c)c(=o)n2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** nofnclgcujjpku-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 196.165 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-11520]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1,7-dimethylurate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nofnclgcujjpku-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=196.165}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-12483
- common-name:
- 1,7-dimethylurate
- smiles:
- cn1(c(=o)nc2(=c1c(=o)n(c)c(=o)n2))
- inchi-key:
- nofnclgcujjpku-uhfffaoysa-n
- molecular-weight:
- 196.165
