Difference between revisions of "CPD-12483"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11210 RXN-11210] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:metabolite == Metabolite CPD-12483 == * common-name: ** 1,7-dimethylurate * smiles: ** cn1(c(=o)nc2(=c1c(=o)n(c)c(=o)n2)) * inchi-key: ** nofnclgcujjpku-uhfffaoys...") |
||
| (7 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-12483 == |
| − | * | + | * common-name: |
| − | ** | + | ** 1,7-dimethylurate |
| − | * | + | * smiles: |
| − | ** | + | ** cn1(c(=o)nc2(=c1c(=o)n(c)c(=o)n2)) |
| − | == | + | * inchi-key: |
| − | + | ** nofnclgcujjpku-uhfffaoysa-n | |
| − | + | * molecular-weight: | |
| − | * | + | ** 196.165 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | ** | + | * [[RXN-11520]] |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=1,7-dimethylurate}} | |
| − | + | {{#set: inchi-key=inchikey=nofnclgcujjpku-uhfffaoysa-n}} | |
| − | + | {{#set: molecular-weight=196.165}} | |
| − | * | ||
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-12483
- common-name:
- 1,7-dimethylurate
- smiles:
- cn1(c(=o)nc2(=c1c(=o)n(c)c(=o)n2))
- inchi-key:
- nofnclgcujjpku-uhfffaoysa-n
- molecular-weight:
- 196.165
