Difference between revisions of "CPD-12483"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPDQT-4 == * common-name: ** β-l-galactose 1-phosphate * smiles: ** c(o)c1(c(o)c(o)c(o)c(op([o-])([o-])=o)o1) * inchi-key: ** hxxfsf...") |
(Created page with "Category:metabolite == Metabolite NARINGENIN-CMPD == * common-name: ** (2s)-naringenin * smiles: ** c3(=c(c2(oc1(c(=c(c=c(c=1)o)o)c(c2)=o)))c=cc(=c3)o) * inchi-key: ** ftv...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite NARINGENIN-CMPD == |
* common-name: | * common-name: | ||
| − | ** | + | ** (2s)-naringenin |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c3(=c(c2(oc1(c(=c(c=c(c=1)o)o)c(c2)=o)))c=cc(=c3)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ftvwirxfelqlpi-zdusscgksa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 272.257 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[NARINGENIN-3-DIOXYGENASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[APIGNAR-RXN]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2s)-naringenin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ftvwirxfelqlpi-zdusscgksa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=272.257}} |
Revision as of 13:11, 14 January 2021
Contents
Metabolite NARINGENIN-CMPD
- common-name:
- (2s)-naringenin
- smiles:
- c3(=c(c2(oc1(c(=c(c=c(c=1)o)o)c(c2)=o)))c=cc(=c3)o)
- inchi-key:
- ftvwirxfelqlpi-zdusscgksa-n
- molecular-weight:
- 272.257
