Difference between revisions of "CPD-12565"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPDMETA-13652 == * common-name: ** raucaffrinoline * smiles: ** cc3(n5(c2(c1(=nc6(=cc=cc=c(c41(c(c(c(c2)c(co)3)c(c4)5)oc(=o)c))6))))) * i...") |
(Created page with "Category:metabolite == Metabolite CPD-12565 == * common-name: ** n-acetyl-d-galactosamine 6-o-sulfate * smiles: ** cc(=o)nc1(c(o)oc(cos(=o)(=o)[o-])c(o)c(o)1) * inchi-key:...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-12565 == |
* common-name: | * common-name: | ||
− | ** | + | ** n-acetyl-d-galactosamine 6-o-sulfate |
* smiles: | * smiles: | ||
− | ** | + | ** cc(=o)nc1(c(o)oc(cos(=o)(=o)[o-])c(o)c(o)1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** wjfveeaiyioath-kewyirbnsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 300.26 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-12177]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=n-acetyl-d-galactosamine 6-o-sulfate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wjfveeaiyioath-kewyirbnsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=300.26}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-12565
- common-name:
- n-acetyl-d-galactosamine 6-o-sulfate
- smiles:
- cc(=o)nc1(c(o)oc(cos(=o)(=o)[o-])c(o)c(o)1)
- inchi-key:
- wjfveeaiyioath-kewyirbnsa-m
- molecular-weight:
- 300.26