Difference between revisions of "CPD-12565"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ01661 == * transcription-direction: ** negative * right-end-position: ** 149656 * left-end-position: ** 132406 * centisome-position: ** 24.0934...") |
(Created page with "Category:metabolite == Metabolite CPD-12565 == * common-name: ** n-acetyl-d-galactosamine 6-o-sulfate * smiles: ** cc(=o)nc1(c(o)oc(cos(=o)(=o)[o-])c(o)c(o)1) * inchi-key:...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-12565 == |
− | * | + | * common-name: |
− | ** | + | ** n-acetyl-d-galactosamine 6-o-sulfate |
− | * | + | * smiles: |
− | ** | + | ** cc(=o)nc1(c(o)oc(cos(=o)(=o)[o-])c(o)c(o)1) |
− | * | + | * inchi-key: |
− | ** | + | ** wjfveeaiyioath-kewyirbnsa-m |
− | * | + | * molecular-weight: |
− | ** | + | ** 300.26 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | * [[RXN-12177]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=n-acetyl-d-galactosamine 6-o-sulfate}} | |
− | + | {{#set: inchi-key=inchikey=wjfveeaiyioath-kewyirbnsa-m}} | |
− | + | {{#set: molecular-weight=300.26}} | |
− | |||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-12565
- common-name:
- n-acetyl-d-galactosamine 6-o-sulfate
- smiles:
- cc(=o)nc1(c(o)oc(cos(=o)(=o)[o-])c(o)c(o)1)
- inchi-key:
- wjfveeaiyioath-kewyirbnsa-m
- molecular-weight:
- 300.26