Difference between revisions of "CPD-12565"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Hypoxanthine-37-In-tRNA-Alanines == * common-name: ** a hypoxanthine37 in trnaala == Reaction(s) known to consume the compound == * RXN...")
(Created page with "Category:metabolite == Metabolite CPD-12565 == * common-name: ** n-acetyl-d-galactosamine 6-o-sulfate * smiles: ** cc(=o)nc1(c(o)oc(cos(=o)(=o)[o-])c(o)c(o)1) * inchi-key:...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Hypoxanthine-37-In-tRNA-Alanines ==
+
== Metabolite CPD-12565 ==
 
* common-name:
 
* common-name:
** a hypoxanthine37 in trnaala
+
** n-acetyl-d-galactosamine 6-o-sulfate
 +
* smiles:
 +
** cc(=o)nc1(c(o)oc(cos(=o)(=o)[o-])c(o)c(o)1)
 +
* inchi-key:
 +
** wjfveeaiyioath-kewyirbnsa-m
 +
* molecular-weight:
 +
** 300.26
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13996]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13996]]
+
* [[RXN-12177]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a hypoxanthine37 in trnaala}}
+
{{#set: common-name=n-acetyl-d-galactosamine 6-o-sulfate}}
 +
{{#set: inchi-key=inchikey=wjfveeaiyioath-kewyirbnsa-m}}
 +
{{#set: molecular-weight=300.26}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-12565

  • common-name:
    • n-acetyl-d-galactosamine 6-o-sulfate
  • smiles:
    • cc(=o)nc1(c(o)oc(cos(=o)(=o)[o-])c(o)c(o)1)
  • inchi-key:
    • wjfveeaiyioath-kewyirbnsa-m
  • molecular-weight:
    • 300.26

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality