Difference between revisions of "CPD-12565"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ09103 == * transcription-direction: ** negative * right-end-position: ** 31578 * left-end-position: ** 29948 * centisome-position: ** 66.44332...")
(Created page with "Category:metabolite == Metabolite LYS == * common-name: ** l-lysine * smiles: ** c([n+])cccc([n+])c([o-])=o * inchi-key: ** kdxkernsbixsrk-yfkpbyrvsa-o * molecular-weight:...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ09103 ==
+
== Metabolite LYS ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** l-lysine
−
* right-end-position:
+
* smiles:
−
** 31578
+
** c([n+])cccc([n+])c([o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 29948
+
** kdxkernsbixsrk-yfkpbyrvsa-o
−
* centisome-position:
+
* molecular-weight:
−
** 66.44332   
+
** 147.197
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[LYSINE--TRNA-LIGASE-RXN]]
−
== Reaction(s) associated ==
+
* [[LYSINE-N-ACETYLTRANSFERASE-RXN]]
 +
* [[RXN-1961]]
 +
* [[biomass_rxn]]
 +
== Reaction(s) known to produce the compound ==
 
* [[DIAMINOPIMDECARB-RXN]]
 
* [[DIAMINOPIMDECARB-RXN]]
−
** Category: [[annotation]]
+
* [[LYSINE-N-ACETYLTRANSFERASE-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=l-lysine}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=kdxkernsbixsrk-yfkpbyrvsa-o}}
−
== Pathway(s) associated ==
+
{{#set: molecular-weight=147.197}}
−
* [[PWY-2942]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-5097]]
 
−
** '''7''' reactions found over '''7''' reactions in the full pathway
 
−
* [[DAPLYSINESYN-PWY]]
 
−
** '''7''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-2941]]
 
−
** '''6''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=31578}}
 
−
{{#set: left-end-position=29948}}
 
−
{{#set: centisome-position=66.44332    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 
−
{{#set: nb pathway associated=4}}
 

Revision as of 20:33, 18 December 2020

Metabolite LYS

  • common-name:
    • l-lysine
  • smiles:
    • c([n+])cccc([n+])c([o-])=o
  • inchi-key:
    • kdxkernsbixsrk-yfkpbyrvsa-o
  • molecular-weight:
    • 147.197

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-12565&oldid=46795"