Difference between revisions of "CPD-12565"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-HYDROXYINDOLE_ACETATE == * common-name: ** 5-hydroxyindole acetate * smiles: ** c1(c(o)=cc2(=c(c=1)nc=c2cc(=o)[o-])) * inchi-key: ** du...")
(Created page with "Category:metabolite == Metabolite CPD-4209 == * common-name: ** n6-dimethylallyladenine * smiles: ** cc(c)=ccnc1(=nc=nc2(nc=nc1=2)) * inchi-key: ** hyvabzigrdekcd-uhfffaoy...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-HYDROXYINDOLE_ACETATE ==
+
== Metabolite CPD-4209 ==
 
* common-name:
 
* common-name:
** 5-hydroxyindole acetate
+
** n6-dimethylallyladenine
 
* smiles:
 
* smiles:
** c1(c(o)=cc2(=c(c=1)nc=c2cc(=o)[o-]))
+
** cc(c)=ccnc1(=nc=nc2(nc=nc1=2))
 
* inchi-key:
 
* inchi-key:
** duugkqcegzlzno-uhfffaoysa-m
+
** hyvabzigrdekcd-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 190.178
+
** 203.246
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[1.5.99.12-RXN]]
 +
* [[RXN-4315]]
 +
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
 +
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10780]]
+
* [[1.5.99.12-RXN]]
 +
* [[RXN-4313]]
 +
* [[RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.]]
 +
* [[RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.]]
 +
* [[RXN-4315]]
 +
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
 +
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-hydroxyindole acetate}}
+
{{#set: common-name=n6-dimethylallyladenine}}
{{#set: inchi-key=inchikey=duugkqcegzlzno-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=hyvabzigrdekcd-uhfffaoysa-n}}
{{#set: molecular-weight=190.178}}
+
{{#set: molecular-weight=203.246}}

Revision as of 13:10, 14 January 2021