Difference between revisions of "CPD-12565"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-HYDROXYINDOLE_ACETATE == * common-name: ** 5-hydroxyindole acetate * smiles: ** c1(c(o)=cc2(=c(c=1)nc=c2cc(=o)[o-])) * inchi-key: ** du...") |
(Created page with "Category:metabolite == Metabolite CPD-4209 == * common-name: ** n6-dimethylallyladenine * smiles: ** cc(c)=ccnc1(=nc=nc2(nc=nc1=2)) * inchi-key: ** hyvabzigrdekcd-uhfffaoy...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-4209 == |
* common-name: | * common-name: | ||
− | ** | + | ** n6-dimethylallyladenine |
* smiles: | * smiles: | ||
− | ** | + | ** cc(c)=ccnc1(=nc=nc2(nc=nc1=2)) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** hyvabzigrdekcd-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 203.246 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[1.5.99.12-RXN]] | ||
+ | * [[RXN-4315]] | ||
+ | * [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]] | ||
+ | * [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[1.5.99.12-RXN]] |
+ | * [[RXN-4313]] | ||
+ | * [[RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.]] | ||
+ | * [[RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.]] | ||
+ | * [[RXN-4315]] | ||
+ | * [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]] | ||
+ | * [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=n6-dimethylallyladenine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hyvabzigrdekcd-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=203.246}} |
Revision as of 13:10, 14 January 2021
Contents
Metabolite CPD-4209
- common-name:
- n6-dimethylallyladenine
- smiles:
- cc(c)=ccnc1(=nc=nc2(nc=nc1=2))
- inchi-key:
- hyvabzigrdekcd-uhfffaoysa-n
- molecular-weight:
- 203.246
Reaction(s) known to consume the compound
- 1.5.99.12-RXN
- RXN-4315
- RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.
- RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.
Reaction(s) known to produce the compound
- 1.5.99.12-RXN
- RXN-4313
- RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.
- RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.
- RXN-4315
- RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.
- RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.