Difference between revisions of "CPD-12565"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4209 == * common-name: ** n6-dimethylallyladenine * smiles: ** cc(c)=ccnc1(=nc=nc2(nc=nc1=2)) * inchi-key: ** hyvabzigrdekcd-uhfffaoy...") |
(Created page with "Category:metabolite == Metabolite Hypoxanthine-37-In-tRNA-Alanines == * common-name: ** a hypoxanthine37 in trnaala == Reaction(s) known to consume the compound == * RXN...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Hypoxanthine-37-In-tRNA-Alanines == |
* common-name: | * common-name: | ||
− | ** | + | ** a hypoxanthine37 in trnaala |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-13996]] | |
− | |||
− | |||
− | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[RXN-13996]] | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a hypoxanthine37 in trnaala}} |
− | |||
− |
Revision as of 18:55, 14 January 2021
Contents
Metabolite Hypoxanthine-37-In-tRNA-Alanines
- common-name:
- a hypoxanthine37 in trnaala