Difference between revisions of "CPD-12565"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ09103 == * transcription-direction: ** negative * right-end-position: ** 31578 * left-end-position: ** 29948 * centisome-position: ** 66.44332...") |
(Created page with "Category:metabolite == Metabolite LYS == * common-name: ** l-lysine * smiles: ** c([n+])cccc([n+])c([o-])=o * inchi-key: ** kdxkernsbixsrk-yfkpbyrvsa-o * molecular-weight:...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite LYS == |
− | * | + | * common-name: |
− | ** | + | ** l-lysine |
− | * | + | * smiles: |
− | ** | + | ** c([n+])cccc([n+])c([o-])=o |
− | * | + | * inchi-key: |
− | ** | + | ** kdxkernsbixsrk-yfkpbyrvsa-o |
− | * | + | * molecular-weight: |
− | ** | + | ** 147.197 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[LYSINE--TRNA-LIGASE-RXN]] |
− | == Reaction(s) | + | * [[LYSINE-N-ACETYLTRANSFERASE-RXN]] |
+ | * [[RXN-1961]] | ||
+ | * [[biomass_rxn]] | ||
+ | == Reaction(s) known to produce the compound == | ||
* [[DIAMINOPIMDECARB-RXN]] | * [[DIAMINOPIMDECARB-RXN]] | ||
− | * | + | * [[LYSINE-N-ACETYLTRANSFERASE-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=l-lysine}} | |
− | + | {{#set: inchi-key=inchikey=kdxkernsbixsrk-yfkpbyrvsa-o}} | |
− | == | + | {{#set: molecular-weight=147.197}} |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:33, 18 December 2020
Contents
Metabolite LYS
- common-name:
- l-lysine
- smiles:
- c([n+])cccc([n+])c([o-])=o
- inchi-key:
- kdxkernsbixsrk-yfkpbyrvsa-o
- molecular-weight:
- 147.197