Difference between revisions of "CPD-12575"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ11978 == * transcription-direction: ** positive * right-end-position: ** 11682 * left-end-position: ** 5832 * centisome-position: ** 1.6083218...")
(Created page with "Category:metabolite == Metabolite CPD-12575 == * common-name: ** udp-α-d-glucose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ11978 ==
+
== Metabolite CPD-12575 ==
* transcription-direction:
+
* common-name:
** positive
+
** udp-α-d-glucose
* right-end-position:
+
* smiles:
** 11682
+
** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)
* left-end-position:
+
* inchi-key:
** 5832
+
** hscjrczfdfqwrp-jzmiexbbsa-l
* centisome-position:
+
* molecular-weight:
** 1.6083218   
+
** 564.289
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
== Reaction(s) associated ==
+
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
* [[RXN0-6377]]
+
* [[2.4.1.117-RXN]]
** Category: [[annotation]]
+
* [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[GALACTURIDYLYLTRANS-RXN]]
== Pathway(s) associated ==
+
* [[GLUC1PURIDYLTRANS-RXN]]
* [[PWY-723]]
+
* [[GLYCOGENIN-GLUCOSYLTRANSFERASE-RXN]]
** '''2''' reactions found over '''2''' reactions in the full pathway
+
* [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
* [[PWY-5675]]
+
* [[RXN-12123]]
** '''4''' reactions found over '''4''' reactions in the full pathway
+
* [[RXN-12125]]
{{#set: transcription-direction=positive}}
+
* [[RXN-12126]]
{{#set: right-end-position=11682}}
+
* [[RXN-12127]]
{{#set: left-end-position=5832}}
+
* [[RXN-12128]]
{{#set: centisome-position=1.6083218    }}
+
* [[RXN-1223]]
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[RXN-15117]]
{{#set: nb reaction associated=1}}
+
* [[RXN-16975]]
{{#set: nb pathway associated=2}}
+
* [[RXN-4726]]
 +
* [[RXN-4733]]
 +
* [[RXN-5482]]
 +
* [[RXN-7667]]
 +
* [[RXN-7828]]
 +
* [[RXN-8228]]
 +
* [[RXN1F-461]]
 +
* [[RXN1F-462]]
 +
* [[STEROL-GLUCOSYLTRANSFERASE-RXN]]
 +
* [[TREHALOSE6PSYN-RXN]]
 +
* [[UDP-GLUCOSE-46-DEHYDRATASE-RXN]]
 +
* [[UDPGLUCEPIM-RXN]]
 +
* [[UDPGth]]
 +
* [[UG4E]]
 +
* [[UG6PGT]]
 +
* [[UG6PGTn]]
 +
* [[UGD-RXN]]
 +
* [[UGDH]]
 +
</div>
 +
== Reaction(s) known to produce the compound ==
 +
* [[GALACTURIDYLYLTRANS-RXN]]
 +
* [[GLUC1PURIDYLTRANS-RXN]]
 +
* [[UDPGLUCEPIM-RXN]]
 +
* [[UDPGth]]
 +
* [[UG1PUT]]
 +
* [[UG4E]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=udp-&alpha;-d-glucose}}
 +
{{#set: inchi-key=inchikey=hscjrczfdfqwrp-jzmiexbbsa-l}}
 +
{{#set: molecular-weight=564.289}}

Latest revision as of 11:14, 18 March 2021