Difference between revisions of "CPD-12575"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ARYLDIALKYL-PHOSPHATASE-RXN ARYLDIALKYL-PHOSPHATASE-RXN] == * direction: ** left-to-right * common-...")
(Created page with "Category:metabolite == Metabolite CPD-12575 == * common-name: ** udp-α-d-glucose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ARYLDIALKYL-PHOSPHATASE-RXN ARYLDIALKYL-PHOSPHATASE-RXN] ==
+
== Metabolite CPD-12575 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** aryldialkylphosphatase
+
** udp-α-d-glucose
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.1.8.1 ec-3.1.8.1]
+
** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[PARATHION]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[DIETHYLTHIOPHOSPHATE]][c] '''+''' 1 [[P-NITROPHENOL]][c] '''+''' 2 [[PROTON]][c]
+
** hscjrczfdfqwrp-jzmiexbbsa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ11006]]
+
** 564.289
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
* Gene: [[SJ15519]]
+
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
−
** Category: [[annotation]]
+
* [[2.4.1.117-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]]
−
== Pathway(s)  ==
+
* [[GALACTURIDYLYLTRANS-RXN]]
−
* [[PARATHION-DEGRADATION-PWY]], parathion degradation: [http://metacyc.org/META/NEW-IMAGE?object=PARATHION-DEGRADATION-PWY PARATHION-DEGRADATION-PWY]
+
* [[GLUC1PURIDYLTRANS-RXN]]
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
* [[GLYCOGENIN-GLUCOSYLTRANSFERASE-RXN]]
−
== Reconstruction information  ==
+
* [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-12123]]
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-12125]]
−
== External links  ==
+
* [[RXN-12126]]
−
* LIGAND-RXN:
+
* [[RXN-12127]]
−
** [http://www.genome.jp/dbget-bin/www_bget?R05421 R05421]
+
* [[RXN-12128]]
−
* UNIPROT:
+
* [[RXN-1223]]
−
** [http://www.uniprot.org/uniprot/P27169 P27169]
+
* [[RXN-15117]]
−
** [http://www.uniprot.org/uniprot/P27170 P27170]
+
* [[RXN-16975]]
−
** [http://www.uniprot.org/uniprot/P52430 P52430]
+
* [[RXN-4726]]
−
{{#set: direction=left-to-right}}
+
* [[RXN-4733]]
−
{{#set: common-name=aryldialkylphosphatase}}
+
* [[RXN-5482]]
−
{{#set: ec-number=ec-3.1.8.1}}
+
* [[RXN-7667]]
−
{{#set: nb gene associated=2}}
+
* [[RXN-7828]]
−
{{#set: nb pathway associated=1}}
+
* [[RXN-8228]]
−
{{#set: reconstruction category=annotation|orthology}}
+
* [[RXN1F-461]]
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+
* [[RXN1F-462]]
−
{{#set: reconstruction comment=n.a}}
+
* [[STEROL-GLUCOSYLTRANSFERASE-RXN]]
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
+
* [[TREHALOSE6PSYN-RXN]]
 +
* [[UDP-GLUCOSE-46-DEHYDRATASE-RXN]]
 +
* [[UDPGLUCEPIM-RXN]]
 +
* [[UDPGth]]
 +
* [[UG4E]]
 +
* [[UG6PGT]]
 +
* [[UG6PGTn]]
 +
* [[UGD-RXN]]
 +
* [[UGDH]]
 +
</div>
 +
== Reaction(s) known to produce the compound ==
 +
* [[GALACTURIDYLYLTRANS-RXN]]
 +
* [[GLUC1PURIDYLTRANS-RXN]]
 +
* [[UDPGLUCEPIM-RXN]]
 +
* [[UDPGth]]
 +
* [[UG1PUT]]
 +
* [[UG4E]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=udp-&alpha;-d-glucose}}
 +
{{#set: inchi-key=inchikey=hscjrczfdfqwrp-jzmiexbbsa-l}}
 +
{{#set: molecular-weight=564.289}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-12575

  • common-name:
    • udp-α-d-glucose
  • smiles:
    • c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)
  • inchi-key:
    • hscjrczfdfqwrp-jzmiexbbsa-l
  • molecular-weight:
    • 564.289

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-12575&oldid=138340"