Difference between revisions of "CPD-12575"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ12971 == * transcription-direction: ** negative * right-end-position: ** 165145 * left-end-position: ** 139845 * centisome-position: ** 40.1361...")
 
(Created page with "Category:metabolite == Metabolite CPD-12575 == * common-name: ** udp-α-d-glucose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ12971 ==
+
== Metabolite CPD-12575 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** udp-α-d-glucose
−
* right-end-position:
+
* smiles:
−
** 165145
+
** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)
−
* left-end-position:
+
* inchi-key:
−
** 139845
+
** hscjrczfdfqwrp-jzmiexbbsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 40.1361   
+
** 564.289
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
 
−
== Reaction(s) associated ==
 
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
* [[ATPASE-RXN]]
+
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
−
** Category: [[annotation]]
+
* [[2.4.1.117-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]]
−
** Category: [[orthology]]
+
* [[GALACTURIDYLYLTRANS-RXN]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[GLUC1PURIDYLTRANS-RXN]]
−
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
* [[GLYCOGENIN-GLUCOSYLTRANSFERASE-RXN]]
−
** Category: [[annotation]]
+
* [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-12123]]
−
** Category: [[orthology]]
+
* [[RXN-12125]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-12126]]
−
* [[RXN-12195]]
+
* [[RXN-12127]]
−
** Category: [[annotation]]
+
* [[RXN-12128]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-1223]]
−
** Category: [[orthology]]
+
* [[RXN-15117]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-16975]]
−
* [[RXN-12196]]
+
* [[RXN-4726]]
−
** Category: [[annotation]]
+
* [[RXN-4733]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-5482]]
−
** Category: [[orthology]]
+
* [[RXN-7667]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-7828]]
−
* [[RXN0-5462]]
+
* [[RXN-8228]]
−
** Category: [[annotation]]
+
* [[RXN1F-461]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN1F-462]]
−
** Category: [[orthology]]
+
* [[STEROL-GLUCOSYLTRANSFERASE-RXN]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[TREHALOSE6PSYN-RXN]]
 +
* [[UDP-GLUCOSE-46-DEHYDRATASE-RXN]]
 +
* [[UDPGLUCEPIM-RXN]]
 +
* [[UDPGth]]
 +
* [[UG4E]]
 +
* [[UG6PGT]]
 +
* [[UG6PGTn]]
 +
* [[UGD-RXN]]
 +
* [[UGDH]]
 
</div>
 
</div>
−
== Pathway(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[PWY-7210]]
+
* [[GALACTURIDYLYLTRANS-RXN]]
−
** '''8''' reactions found over '''8''' reactions in the full pathway
+
* [[GLUC1PURIDYLTRANS-RXN]]
−
* [[PWY-7198]]
+
* [[UDPGLUCEPIM-RXN]]
−
** '''6''' reactions found over '''7''' reactions in the full pathway
+
* [[UDPGth]]
−
* [[PWY-7184]]
+
* [[UG1PUT]]
−
** '''9''' reactions found over '''9''' reactions in the full pathway
+
* [[UG4E]]
−
* [[PWY-6545]]
+
== Reaction(s) of unknown directionality ==
−
** '''8''' reactions found over '''9''' reactions in the full pathway
+
{{#set: common-name=udp-&alpha;-d-glucose}}
−
{{#set: transcription-direction=negative}}
+
{{#set: inchi-key=inchikey=hscjrczfdfqwrp-jzmiexbbsa-l}}
−
{{#set: right-end-position=165145}}
+
{{#set: molecular-weight=564.289}}
−
{{#set: left-end-position=139845}}
 
−
{{#set: centisome-position=40.1361    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-12575

  • common-name:
    • udp-α-d-glucose
  • smiles:
    • c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)
  • inchi-key:
    • hscjrczfdfqwrp-jzmiexbbsa-l
  • molecular-weight:
    • 564.289

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-12575&oldid=138340"