Difference between revisions of "CPD-12581"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite OLEOYL-COA == * common-name: ** oleoyl-coa * smiles: ** ccccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])...") |
(Created page with "Category:metabolite == Metabolite CPD-12581 == * common-name: ** s-(2e,6e)-farnesyl-l-cysteine * smiles: ** cc(c)=cccc(c)=cccc(c)=ccscc([n+])c(=o)[o-] * inchi-key: ** sysl...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12581 == |
* common-name: | * common-name: | ||
| − | ** | + | ** s-(2e,6e)-farnesyl-l-cysteine |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)=cccc(c)=cccc(c)=ccscc([n+])c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** syslnqmklrogcl-bcyuyympsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 325.508 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-11623]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=s-(2e,6e)-farnesyl-l-cysteine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=syslnqmklrogcl-bcyuyympsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=325.508}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-12581
- common-name:
- s-(2e,6e)-farnesyl-l-cysteine
- smiles:
- cc(c)=cccc(c)=cccc(c)=ccscc([n+])c(=o)[o-]
- inchi-key:
- syslnqmklrogcl-bcyuyympsa-n
- molecular-weight:
- 325.508
