Difference between revisions of "CPD-12581"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ10681 == * transcription-direction: ** positive * right-end-position: ** 455954 * left-end-position: ** 445107 * centisome-position: ** 56.47835...")
(Created page with "Category:metabolite == Metabolite CPD-12581 == * common-name: ** s-(2e,6e)-farnesyl-l-cysteine * smiles: ** cc(c)=cccc(c)=cccc(c)=ccscc([n+])c(=o)[o-] * inchi-key: ** sysl...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ10681 ==
+
== Metabolite CPD-12581 ==
* transcription-direction:
+
* common-name:
** positive
+
** s-(2e,6e)-farnesyl-l-cysteine
* right-end-position:
+
* smiles:
** 455954
+
** cc(c)=cccc(c)=cccc(c)=ccscc([n+])c(=o)[o-]
* left-end-position:
+
* inchi-key:
** 445107
+
** syslnqmklrogcl-bcyuyympsa-n
* centisome-position:
+
* molecular-weight:
** 56.47835   
+
** 325.508
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-11623]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[3.1.6.12-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=s-(2e,6e)-farnesyl-l-cysteine}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=syslnqmklrogcl-bcyuyympsa-n}}
* [[ARYLSULFAT-RXN]]
+
{{#set: molecular-weight=325.508}}
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=455954}}
 
{{#set: left-end-position=445107}}
 
{{#set: centisome-position=56.47835    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-12581

  • common-name:
    • s-(2e,6e)-farnesyl-l-cysteine
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=ccscc([n+])c(=o)[o-]
  • inchi-key:
    • syslnqmklrogcl-bcyuyympsa-n
  • molecular-weight:
    • 325.508

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality