Difference between revisions of "CPD-12581"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ02444 == * transcription-direction: ** negative * right-end-position: ** 45953 * left-end-position: ** 39430 * centisome-position: ** 29.082245...") |
(Created page with "Category:metabolite == Metabolite CPD-12581 == * common-name: ** s-(2e,6e)-farnesyl-l-cysteine * smiles: ** cc(c)=cccc(c)=cccc(c)=ccscc([n+])c(=o)[o-] * inchi-key: ** sysl...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-12581 == |
− | * | + | * common-name: |
− | ** | + | ** s-(2e,6e)-farnesyl-l-cysteine |
− | + | * smiles: | |
− | + | ** cc(c)=cccc(c)=cccc(c)=ccscc([n+])c(=o)[o-] | |
− | + | * inchi-key: | |
− | * | + | ** syslnqmklrogcl-bcyuyympsa-n |
− | + | * molecular-weight: | |
− | ** | + | ** 325.508 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-11623]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=s-(2e,6e)-farnesyl-l-cysteine}} | |
− | * | + | {{#set: inchi-key=inchikey=syslnqmklrogcl-bcyuyympsa-n}} |
− | + | {{#set: molecular-weight=325.508}} | |
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-12581
- common-name:
- s-(2e,6e)-farnesyl-l-cysteine
- smiles:
- cc(c)=cccc(c)=cccc(c)=ccscc([n+])c(=o)[o-]
- inchi-key:
- syslnqmklrogcl-bcyuyympsa-n
- molecular-weight:
- 325.508