Difference between revisions of "CPD-12581"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17293 == * common-name: ** a [glycerolipid]-(7z,10z)-hexadecadienoate == Reaction(s) known to consume the compound == * RXN-16049...")
(Created page with "Category:metabolite == Metabolite CPD-12581 == * common-name: ** s-(2e,6e)-farnesyl-l-cysteine * smiles: ** cc(c)=cccc(c)=cccc(c)=ccscc([n+])c(=o)[o-] * inchi-key: ** sysl...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17293 ==
+
== Metabolite CPD-12581 ==
 
* common-name:
 
* common-name:
** a [glycerolipid]-(7z,10z)-hexadecadienoate
+
** s-(2e,6e)-farnesyl-l-cysteine
 +
* smiles:
 +
** cc(c)=cccc(c)=cccc(c)=ccscc([n+])c(=o)[o-]
 +
* inchi-key:
 +
** syslnqmklrogcl-bcyuyympsa-n
 +
* molecular-weight:
 +
** 325.508
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16049]]
+
* [[RXN-11623]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [glycerolipid]-(7z,10z)-hexadecadienoate}}
+
{{#set: common-name=s-(2e,6e)-farnesyl-l-cysteine}}
 +
{{#set: inchi-key=inchikey=syslnqmklrogcl-bcyuyympsa-n}}
 +
{{#set: molecular-weight=325.508}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-12581

  • common-name:
    • s-(2e,6e)-farnesyl-l-cysteine
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=ccscc([n+])c(=o)[o-]
  • inchi-key:
    • syslnqmklrogcl-bcyuyympsa-n
  • molecular-weight:
    • 325.508

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality