Difference between revisions of "CPD-12601"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ12798 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * CDPDIGLYSYN-RXN ** Cat...") |
(Created page with "Category:metabolite == Metabolite CPD-12601 == * common-name: ** β-d-mannopyranose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o)o1) * inchi-key: ** wqzgkkkjijffok-rwopyejcsa-n...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-12601 == |
| − | + | * common-name: | |
| − | * | + | ** β-d-mannopyranose |
| − | + | * smiles: | |
| − | * | + | ** c(o)c1(c(o)c(o)c(o)c(o)o1) |
| − | * | + | * inchi-key: |
| − | *** | + | ** wqzgkkkjijffok-rwopyejcsa-n |
| − | * | + | * molecular-weight: |
| − | * | + | ** 180.157 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | == | + | * [[MANNKIN-RXN-CPD-12601/ATP//MANNOSE-6P/ADP/PROTON.37.]] |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=β-d-mannopyranose}} | |
| − | + | {{#set: inchi-key=inchikey=wqzgkkkjijffok-rwopyejcsa-n}} | |
| − | + | {{#set: molecular-weight=180.157}} | |
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-12601
- common-name:
- β-d-mannopyranose
- smiles:
- c(o)c1(c(o)c(o)c(o)c(o)o1)
- inchi-key:
- wqzgkkkjijffok-rwopyejcsa-n
- molecular-weight:
- 180.157
