Difference between revisions of "CPD-12658"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13014 == * common-name: ** tributyrin * smiles: ** cccc(occ(oc(ccc)=o)coc(ccc)=o)=o * inchi-key: ** uyxtwwcetriedr-uhfffaoysa-n * mol...") |
(Created page with "Category:metabolite == Metabolite CPD-3762 == * common-name: ** 5-amino-4-imidazolecarboxyamide * smiles: ** c1(=nc(c(n)=o)c(n)=n1) * inchi-key: ** pyndtgftpozgrw-uhfffaoy...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-3762 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-amino-4-imidazolecarboxyamide |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(=nc(c(n)=o)c(n)=n1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pyndtgftpozgrw-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 126.118 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14270]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-amino-4-imidazolecarboxyamide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pyndtgftpozgrw-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=126.118}} |
Revision as of 11:15, 15 January 2021
Contents
Metabolite CPD-3762
- common-name:
- 5-amino-4-imidazolecarboxyamide
- smiles:
- c1(=nc(c(n)=o)c(n)=n1)
- inchi-key:
- pyndtgftpozgrw-uhfffaoysa-n
- molecular-weight:
- 126.118
