Difference between revisions of "CPD-12658"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3762 == * common-name: ** 5-amino-4-imidazolecarboxyamide * smiles: ** c1(=nc(c(n)=o)c(n)=n1) * inchi-key: ** pyndtgftpozgrw-uhfffaoy...") |
(Created page with "Category:metabolite == Metabolite CPD-12658 == * common-name: ** riboflavin cyclic-4',5'-phosphate * smiles: ** cc3(c=c2(n=c4(c(=o)n=c(o)n=c(n(cc(o)c(o)c1(cop([o-])(=o)o1)...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-12658 == |
* common-name: | * common-name: | ||
| − | ** | + | ** riboflavin cyclic-4',5'-phosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc3(c=c2(n=c4(c(=o)n=c(o)n=c(n(cc(o)c(o)c1(cop([o-])(=o)o1))c2=cc(c)=3)4))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** cvzkydyrjqyydj-mbnywofbsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 437.325 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-11695]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-11695]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=riboflavin cyclic-4',5'-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cvzkydyrjqyydj-mbnywofbsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=437.325}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-12658
- common-name:
- riboflavin cyclic-4',5'-phosphate
- smiles:
- cc3(c=c2(n=c4(c(=o)n=c(o)n=c(n(cc(o)c(o)c1(cop([o-])(=o)o1))c2=cc(c)=3)4)))
- inchi-key:
- cvzkydyrjqyydj-mbnywofbsa-m
- molecular-weight:
- 437.325
