Difference between revisions of "CPD-12658"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Starch == * common-name: ** starch == Reaction(s) known to consume the compound == * 3.2.1.1-RXN * RXN-1823 == Reaction(s) known...") |
(Created page with "Category:metabolite == Metabolite CPD-12658 == * common-name: ** riboflavin cyclic-4',5'-phosphate * smiles: ** cc3(c=c2(n=c4(c(=o)n=c(o)n=c(n(cc(o)c(o)c1(cop([o-])(=o)o1)...") |
||
| (4 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12658 == |
* common-name: | * common-name: | ||
| − | ** | + | ** riboflavin cyclic-4',5'-phosphate |
| + | * smiles: | ||
| + | ** cc3(c=c2(n=c4(c(=o)n=c(o)n=c(n(cc(o)c(o)c1(cop([o-])(=o)o1))c2=cc(c)=3)4))) | ||
| + | * inchi-key: | ||
| + | ** cvzkydyrjqyydj-mbnywofbsa-m | ||
| + | * molecular-weight: | ||
| + | ** 437.325 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-11695]] | |
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-11695]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=riboflavin cyclic-4',5'-phosphate}} |
| + | {{#set: inchi-key=inchikey=cvzkydyrjqyydj-mbnywofbsa-m}} | ||
| + | {{#set: molecular-weight=437.325}} | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-12658
- common-name:
- riboflavin cyclic-4',5'-phosphate
- smiles:
- cc3(c=c2(n=c4(c(=o)n=c(o)n=c(n(cc(o)c(o)c1(cop([o-])(=o)o1))c2=cc(c)=3)4)))
- inchi-key:
- cvzkydyrjqyydj-mbnywofbsa-m
- molecular-weight:
- 437.325
