Difference between revisions of "CPD-12658"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 23S-rRNA-uridine955-2504-2580 == * common-name: ** uridine955/2504/2580 in 23s rrna == Reaction(s) known to consume the compound == * R...")
(Created page with "Category:metabolite == Metabolite CPD-12658 == * common-name: ** riboflavin cyclic-4',5'-phosphate * smiles: ** cc3(c=c2(n=c4(c(=o)n=c(o)n=c(n(cc(o)c(o)c1(cop([o-])(=o)o1)...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 23S-rRNA-uridine955-2504-2580 ==
+
== Metabolite CPD-12658 ==
 
* common-name:
 
* common-name:
** uridine955/2504/2580 in 23s rrna
+
** riboflavin cyclic-4',5'-phosphate
 +
* smiles:
 +
** cc3(c=c2(n=c4(c(=o)n=c(o)n=c(n(cc(o)c(o)c1(cop([o-])(=o)o1))c2=cc(c)=3)4)))
 +
* inchi-key:
 +
** cvzkydyrjqyydj-mbnywofbsa-m
 +
* molecular-weight:
 +
** 437.325
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11838]]
+
* [[RXN-11695]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-11695]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=uridine955/2504/2580 in 23s rrna}}
+
{{#set: common-name=riboflavin cyclic-4',5'-phosphate}}
 +
{{#set: inchi-key=inchikey=cvzkydyrjqyydj-mbnywofbsa-m}}
 +
{{#set: molecular-weight=437.325}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-12658

  • common-name:
    • riboflavin cyclic-4',5'-phosphate
  • smiles:
    • cc3(c=c2(n=c4(c(=o)n=c(o)n=c(n(cc(o)c(o)c1(cop([o-])(=o)o1))c2=cc(c)=3)4)))
  • inchi-key:
    • cvzkydyrjqyydj-mbnywofbsa-m
  • molecular-weight:
    • 437.325

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality