Difference between revisions of "CPD-12677"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16099 RXN-16099] == * direction: ** left-to-right * common-name: ** icosadienoyl-lipid 8-desatu...")
 
(Created page with "Category:metabolite == Metabolite CPD-12677 == * common-name: ** 5-chloro-5-deoxyribose 1-phosphate * smiles: ** c(cl)c1(c(o)c(o)c(op([o-])(=o)[o-])o1) * inchi-key: ** dgv...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16099 RXN-16099] ==
+
== Metabolite CPD-12677 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** icosadienoyl-lipid 8-desaturase
+
** 5-chloro-5-deoxyribose 1-phosphate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.14.19.4 ec-1.14.19.4]
+
** c(cl)c1(c(o)c(o)c(op([o-])(=o)[o-])o1)
== Reaction formula ==
+
* inchi-key:
* 1 [[CPD-17351]][c] '''+''' 2 [[FERROCYTOCHROME-B5]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[PROTON]][c] '''=>''' 1 [[CPD-17283]][c] '''+''' 2 [[FERRICYTOCHROME-B5]][c] '''+''' 2 [[WATER]][c]
+
** dgviesznpvjdpq-soofdhnksa-l
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ00350]]
+
** 246.541
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
== Pathway(s) ==
+
* [[RXN-11715]]
* [[PWY-7601]], arachidonate biosynthesis IV (8-detaturase, lower eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7601 PWY-7601]
+
== Reaction(s) of unknown directionality ==
** '''5''' reactions found over '''7''' reactions in the full pathway
+
{{#set: common-name=5-chloro-5-deoxyribose 1-phosphate}}
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=dgviesznpvjdpq-soofdhnksa-l}}
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=246.541}}
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=46793 46793]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=icosadienoyl-lipid 8-desaturase}}
 
{{#set: ec-number=ec-1.14.19.4}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-12677

  • common-name:
    • 5-chloro-5-deoxyribose 1-phosphate
  • smiles:
    • c(cl)c1(c(o)c(o)c(op([o-])(=o)[o-])o1)
  • inchi-key:
    • dgviesznpvjdpq-soofdhnksa-l
  • molecular-weight:
    • 246.541

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality