Difference between revisions of "CPD-12692"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SQUALENE == * common-name: ** squalene * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)ccc=c(c)c * inchi-key: ** yygntywphwgjrm-aajyl...") |
(Created page with "Category:metabolite == Metabolite CPD-12692 == * common-name: ** (2r)-3-sulfopropanediol * smiles: ** c(s(=o)(=o)[o-])c(o)co * inchi-key: ** ypfujzaazjxmip-gsvougtgsa-m *...") |
||
| (4 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12692 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (2r)-3-sulfopropanediol |
* smiles: | * smiles: | ||
| − | ** | + | ** c(s(=o)(=o)[o-])c(o)co |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ypfujzaazjxmip-gsvougtgsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 155.145 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-11727]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2r)-3-sulfopropanediol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ypfujzaazjxmip-gsvougtgsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=155.145}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-12692
- common-name:
- (2r)-3-sulfopropanediol
- smiles:
- c(s(=o)(=o)[o-])c(o)co
- inchi-key:
- ypfujzaazjxmip-gsvougtgsa-m
- molecular-weight:
- 155.145
