Difference between revisions of "CPD-12699"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-Adenine-58 == * common-name: ** an adenine58 in trna == Reaction(s) known to consume the compound == * RXN-12466 == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite DIMETHYL-D-RIBITYL-LUMAZINE == * common-name: ** 6,7-dimethyl-8-(1-d-ribityl)lumazine * smiles: ** cc2(=c(c)n(cc(o)c(o)c(o)co)c1(c(c(=o)[...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DIMETHYL-D-RIBITYL-LUMAZINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 6,7-dimethyl-8-(1-d-ribityl)lumazine |
| + | * smiles: | ||
| + | ** cc2(=c(c)n(cc(o)c(o)c(o)co)c1(c(c(=o)[n-]c(=o)n=1)=n2)) | ||
| + | * inchi-key: | ||
| + | ** sxdxrjzuajbnfl-xkssxdpksa-m | ||
| + | * molecular-weight: | ||
| + | ** 325.3 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[RIBOFLAVIN-SYN-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[LUMAZINESYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=6,7-dimethyl-8-(1-d-ribityl)lumazine}} |
| + | {{#set: inchi-key=inchikey=sxdxrjzuajbnfl-xkssxdpksa-m}} | ||
| + | {{#set: molecular-weight=325.3}} | ||
Revision as of 13:07, 14 January 2021
Contents
Metabolite DIMETHYL-D-RIBITYL-LUMAZINE
- common-name:
- 6,7-dimethyl-8-(1-d-ribityl)lumazine
- smiles:
- cc2(=c(c)n(cc(o)c(o)c(o)co)c1(c(c(=o)[n-]c(=o)n=1)=n2))
- inchi-key:
- sxdxrjzuajbnfl-xkssxdpksa-m
- molecular-weight:
- 325.3
